C16H19ClFN5 — CID 166590518
2-chloro-5-[(2-fluoro-6-methylanilino)methyl]-N-[(3R)-pyrrolidin-3-yl]pyrimidin-4-amine (PubChem CID 166590518) has the molecular formula C16H19ClFN5 and a molecular weight of 335.81 g/mol. Its IUPAC name is 2-chloro-5-[(2-fluoro-6-methylanilino)methyl]-N-[(3R)-pyrrolidin-3-yl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-[(2-fluoro-6-methylanilino)methyl]-N-[(3R)-pyrrolidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166590518 |
| Molecular Formula | C16H19ClFN5 |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-chloro-5-[(2-fluoro-6-methylanilino)methyl]-N-[(3R)-pyrrolidin-3-yl]pyrimidin-4-amine |
| SMILES | Cc1cccc(F)c1NCc1cnc(Cl)nc1N[C@@H]1CCNC1 |
| InChI | InChI=1S/C16H19ClFN5/c1-10-3-2-4-13(18)14(10)20-7-11-8-21-16(17)23-15(11)22-12-5-6-19-9-12/h2-4,8,12,19-20H,5-7,9H2,1H3,(H,21,22,23)/t12-/m1/s1 |
| InChIKey | GUKFIOYKODKLKP-GFCCVEGCSA-N |
| XLogP | 2.96 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |