C24H33N3O4 — CID 166591907
3-[6-[(3R)-1-[(2S)-butan-2-yl]-4,4-dimethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166591907) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[6-[(3R)-1-[(2S)-butan-2-yl]-4,4-dimethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3R)-1-[(2S)-butan-2-yl]-4,4-dimethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166591907 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-[6-[(3R)-1-[(2S)-butan-2-yl]-4,4-dimethylpiperidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC[C@H](C)N1CCC(C)(C)[C@@H](Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C24H33N3O4/c1-5-15(2)26-11-10-24(3,4)20(14-26)31-17-6-7-18-16(12-17)13-27(23(18)30)19-8-9-21(28)25-22(19)29/h6-7,12,15,19-20H,5,8-11,13-14H2,1-4H3,(H,25,28,29)/t15-,19?,20-/m0/s1 |
| InChIKey | BSMFJFMUWZOAFK-VBSNWNEZSA-N |
| XLogP | 2.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|