C5H11ClN2 — CID 166597473
2,5-diazabicyclo[4.1.0]heptane;hydrochloride (PubChem CID 166597473) has the molecular formula C5H11ClN2 and a molecular weight of 134.61 g/mol. Its IUPAC name is 2,5-diazabicyclo[4.1.0]heptane;hydrochloride.
| Compound Name | 2,5-diazabicyclo[4.1.0]heptane;hydrochloride |
|---|---|
| PubChem CID | 166597473 |
| Molecular Formula | C5H11ClN2 |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 2,5-diazabicyclo[4.1.0]heptane;hydrochloride |
| SMILES | C1CNC2CC2N1.Cl |
| InChI | InChI=1S/C5H10N2.ClH/c1-2-7-5-3-4(5)6-1;/h4-7H,1-3H2;1H |
| InChIKey | NGYHMKHYCCSRAD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |