About 2,5-diazabicyclo[4.1.0]heptane;hydrochloride
2,5-diazabicyclo[4.1.0]heptane;hydrochloride (PubChem CID 166597473) has the molecular formula C5H11ClN2
and a molecular weight of 134.61 g/mol. Its IUPAC name is 2,5-diazabicyclo[4.1.0]heptane;hydrochloride.
Molecular Properties
| Compound Name | 2,5-diazabicyclo[4.1.0]heptane;hydrochloride |
| PubChem CID | 166597473 |
| Molecular Formula | C5H11ClN2 |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 2,5-diazabicyclo[4.1.0]heptane;hydrochloride |
| SMILES | C1CNC2CC2N1.Cl |
| InChI | InChI=1S/C5H10N2.ClH/c1-2-7-5-3-4(5)6-1;/h4-7H,1-3H2;1H |
| InChIKey | NGYHMKHYCCSRAD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-diazabicyclo[4.1.0]heptane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diazabicyclo[4.1.0]heptane;hydrochloride?
The IUPAC name of 2,5-diazabicyclo[4.1.0]heptane;hydrochloride (CID 166597473) is 2,5-diazabicyclo[4.1.0]heptane;hydrochloride.
What is the SMILES notation for 2,5-diazabicyclo[4.1.0]heptane;hydrochloride?
The canonical SMILES for 2,5-diazabicyclo[4.1.0]heptane;hydrochloride is C1CNC2CC2N1.Cl.
What is the InChIKey of 2,5-diazabicyclo[4.1.0]heptane;hydrochloride?
The InChIKey is NGYHMKHYCCSRAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2.ClH/c1-2-7-5-3-4(5)6-1;/h4-7H,1-3H2;1H.
What are the key properties of 2,5-diazabicyclo[4.1.0]heptane;hydrochloride?
2,5-diazabicyclo[4.1.0]heptane;hydrochloride has a molecular weight of 134.61 g/mol, XLogP of -0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diazabicyclo[4.1.0]heptane;hydrochloride is sourced from PubChem (CID 166597473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).