C9H18N2O — CID 92759205
(4aR,6R,8aS)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline (PubChem CID 92759205) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (4aR,6R,8aS)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline.
| Compound Name | (4aR,6R,8aS)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline |
|---|---|
| PubChem CID | 92759205 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (4aR,6R,8aS)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline |
| SMILES | CO[C@@H]1CC[C@@H]2NCCN[C@@H]2C1 |
| InChI | InChI=1S/C9H18N2O/c1-12-7-2-3-8-9(6-7)11-5-4-10-8/h7-11H,2-6H2,1H3/t7-,8+,9-/m1/s1 |
| InChIKey | OHKIYNPQHVZDHR-HRDYMLBCSA-N |
| XLogP | 0.12 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |