C9H17NO2 — CID 124709188
(4aS,6R,8aS)-6-methoxy-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine (PubChem CID 124709188) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (4aS,6R,8aS)-6-methoxy-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine.
| Compound Name | (4aS,6R,8aS)-6-methoxy-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 124709188 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (4aS,6R,8aS)-6-methoxy-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]oxazine |
| SMILES | CO[C@@H]1CC[C@@H]2OCCN[C@H]2C1 |
| InChI | InChI=1S/C9H17NO2/c1-11-7-2-3-9-8(6-7)10-4-5-12-9/h7-10H,2-6H2,1H3/t7-,8+,9+/m1/s1 |
| InChIKey | HQIXYPVUXMMMRA-VGMNWLOBSA-N |
| XLogP | 0.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |