C18H19ClN4O2S — CID 166597725
1-[4-[[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]thiophen-2-yl]ethanone;hydrochloride (PubChem CID 166597725) has the molecular formula C18H19ClN4O2S and a molecular weight of 390.90 g/mol. Its IUPAC name is 1-[4-[[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]thiophen-2-yl]ethanone;hydrochloride.
| Compound Name | 1-[4-[[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]thiophen-2-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 166597725 |
| Molecular Formula | C18H19ClN4O2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[4-[[3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazol-5-yl]methyl]thiophen-2-yl]ethanone;hydrochloride |
| SMILES | CC(=O)c1cc(Cc2nc(-c3c(C)ncc4c3CCNC4)no2)cs1.Cl |
| InChI | InChI=1S/C18H18N4O2S.ClH/c1-10-17(14-3-4-19-7-13(14)8-20-10)18-21-16(24-22-18)6-12-5-15(11(2)23)25-9-12;/h5,8-9,19H,3-4,6-7H2,1-2H3;1H |
| InChIKey | BLDWDHGAMTWSIW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |