C20H25Cl2N5O2 — CID 166597784
5-[(2-ethyl-6-methyl-3-pyridinyl)oxymethyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;dihydrochloride (PubChem CID 166597784) has the molecular formula C20H25Cl2N5O2 and a molecular weight of 438.36 g/mol. Its IUPAC name is 5-[(2-ethyl-6-methyl-3-pyridinyl)oxymethyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;dihydrochloride.
| Compound Name | 5-[(2-ethyl-6-methyl-3-pyridinyl)oxymethyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;dihydrochloride |
|---|---|
| PubChem CID | 166597784 |
| Molecular Formula | C20H25Cl2N5O2 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 5-[(2-ethyl-6-methyl-3-pyridinyl)oxymethyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;dihydrochloride |
| SMILES | CCc1nc(C)ccc1OCc1nc(-c2c(C)ncc3c2CCNC3)no1.Cl.Cl |
| InChI | InChI=1S/C20H23N5O2.2ClH/c1-4-16-17(6-5-12(2)23-16)26-11-18-24-20(25-27-18)19-13(3)22-10-14-9-21-8-7-15(14)19;;/h5-6,10,21H,4,7-9,11H2,1-3H3;2*1H |
| InChIKey | HCWMTVZLDKLGQR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |