C18H27Cl2N5OS — CID 166597818
3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(2-pyrrolidin-1-ylethylsulfanylmethyl)-1,2,4-oxadiazole;dihydrochloride (PubChem CID 166597818) has the molecular formula C18H27Cl2N5OS and a molecular weight of 432.42 g/mol. Its IUPAC name is 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(2-pyrrolidin-1-ylethylsulfanylmethyl)-1,2,4-oxadiazole;dihydrochloride.
| Compound Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(2-pyrrolidin-1-ylethylsulfanylmethyl)-1,2,4-oxadiazole;dihydrochloride |
|---|---|
| PubChem CID | 166597818 |
| Molecular Formula | C18H27Cl2N5OS |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(2-pyrrolidin-1-ylethylsulfanylmethyl)-1,2,4-oxadiazole;dihydrochloride |
| SMILES | Cc1ncc2c(c1-c1noc(CSCCN3CCCC3)n1)CCNC2.Cl.Cl |
| InChI | InChI=1S/C18H25N5OS.2ClH/c1-13-17(15-4-5-19-10-14(15)11-20-13)18-21-16(24-22-18)12-25-9-8-23-6-2-3-7-23;;/h11,19H,2-10,12H2,1H3;2*1H |
| InChIKey | ZVPYHFXICAIUJJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|