C21H27Cl2N5O2 — CID 166597746
5-[1-(furan-2-ylmethyl)piperidin-3-yl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;dihydrochloride (PubChem CID 166597746) has the molecular formula C21H27Cl2N5O2 and a molecular weight of 452.39 g/mol. Its IUPAC name is 5-[1-(furan-2-ylmethyl)piperidin-3-yl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;dihydrochloride.
| Compound Name | 5-[1-(furan-2-ylmethyl)piperidin-3-yl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;dihydrochloride |
|---|---|
| PubChem CID | 166597746 |
| Molecular Formula | C21H27Cl2N5O2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 5-[1-(furan-2-ylmethyl)piperidin-3-yl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;dihydrochloride |
| SMILES | Cc1ncc2c(c1-c1noc(C3CCCN(Cc4ccco4)C3)n1)CCNC2.Cl.Cl |
| InChI | InChI=1S/C21H25N5O2.2ClH/c1-14-19(18-6-7-22-10-16(18)11-23-14)20-24-21(28-25-20)15-4-2-8-26(12-15)13-17-5-3-9-27-17;;/h3,5,9,11,15,22H,2,4,6-8,10,12-13H2,1H3;2*1H |
| InChIKey | JKZYVSNSCNQPOG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |