C17H19ClN4O2S — CID 166597877
5-[5-(methoxymethyl)thiophen-2-yl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 166597877) has the molecular formula C17H19ClN4O2S and a molecular weight of 378.89 g/mol. Its IUPAC name is 5-[5-(methoxymethyl)thiophen-2-yl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-[5-(methoxymethyl)thiophen-2-yl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 166597877 |
| Molecular Formula | C17H19ClN4O2S |
| Molecular Weight | 378.89 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 5-[5-(methoxymethyl)thiophen-2-yl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | COCc1ccc(-c2nc(-c3c(C)ncc4c3CCNC4)no2)s1.Cl |
| InChI | InChI=1S/C17H18N4O2S.ClH/c1-10-15(13-5-6-18-7-11(13)8-19-10)16-20-17(23-21-16)14-4-3-12(24-14)9-22-2;/h3-4,8,18H,5-7,9H2,1-2H3;1H |
| InChIKey | MOVGYGSRXLZFBL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |