C21H29N3O6 — CID 166598465
(3R,3aR,6R,6aR)-3-[2-[3-[(dimethylamino)methyl]-4-ethoxyphenyl]imidazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;formic acid (PubChem CID 166598465) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-3-[2-[3-[(dimethylamino)methyl]-4-ethoxyphenyl]imidazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;formic acid.
| Compound Name | (3R,3aR,6R,6aR)-3-[2-[3-[(dimethylamino)methyl]-4-ethoxyphenyl]imidazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;formic acid |
|---|---|
| PubChem CID | 166598465 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (3R,3aR,6R,6aR)-3-[2-[3-[(dimethylamino)methyl]-4-ethoxyphenyl]imidazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;formic acid |
| SMILES | CCOc1ccc(-c2nccn2[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)cc1CN(C)C.O=CO |
| InChI | InChI=1S/C20H27N3O4.CH2O2/c1-4-25-17-6-5-13(9-14(17)10-22(2)3)20-21-7-8-23(20)15-11-26-19-16(24)12-27-18(15)19;2-1-3/h5-9,15-16,18-19,24H,4,10-12H2,1-3H3;1H,(H,2,3)/t15-,16-,18-,19-;/m1./s1 |
| InChIKey | ZNBJWSRBQHSNOS-ZNSYCPMGSA-N |
| XLogP | 1.41 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|