C24H36N2O3 — CID 166599730
[(1S,2S,4R)-7-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2-ethyl-7-azabicyclo[2.2.1]heptan-2-yl]methanol;formic acid (PubChem CID 166599730) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is [(1S,2S,4R)-7-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2-ethyl-7-azabicyclo[2.2.1]heptan-2-yl]methanol;formic acid.
| Compound Name | [(1S,2S,4R)-7-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2-ethyl-7-azabicyclo[2.2.1]heptan-2-yl]methanol;formic acid |
|---|---|
| PubChem CID | 166599730 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | [(1S,2S,4R)-7-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-2-ethyl-7-azabicyclo[2.2.1]heptan-2-yl]methanol;formic acid |
| SMILES | CC[C@]1(CO)C[C@H]2CC[C@@H]1N2C1CCN(c2ccc3c(c2)CCC3)CC1.O=CO |
| InChI | InChI=1S/C23H34N2O.CH2O2/c1-2-23(16-26)15-21-8-9-22(23)25(21)19-10-12-24(13-11-19)20-7-6-17-4-3-5-18(17)14-20;2-1-3/h6-7,14,19,21-22,26H,2-5,8-13,15-16H2,1H3;1H,(H,2,3)/t21-,22+,23-;/m1./s1 |
| InChIKey | OJZMTVLZEFEBJK-HZLAGBECSA-N |
| XLogP | 3.47 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|