About 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea
1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea (PubChem CID 166603329) has the molecular formula C17H29N5O
and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea |
| PubChem CID | 166603329 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)C1CCN(c2ccc(C(C)(C)C)nn2)CC1 |
| InChI | InChI=1S/C17H29N5O/c1-17(2,3)14-7-8-15(19-18-14)22-11-9-13(10-12-22)21(6)16(23)20(4)5/h7-8,13H,9-12H2,1-6H3 |
| InChIKey | YNDIIYPHZGBYME-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea?
The IUPAC name of 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea (CID 166603329) is 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea.
What is the SMILES notation for 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea?
The canonical SMILES for 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea is CN(C)C(=O)N(C)C1CCN(c2ccc(C(C)(C)C)nn2)CC1.
What is the InChIKey of 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea?
The InChIKey is YNDIIYPHZGBYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N5O/c1-17(2,3)14-7-8-15(19-18-14)22-11-9-13(10-12-22)21(6)16(23)20(4)5/h7-8,13H,9-12H2,1-6H3.
What are the key properties of 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea?
1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea has a molecular weight of 319.45 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,3,3-trimethylurea is sourced from PubChem (CID 166603329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).