C16H28N4O2S — CID 171691567
N-[[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 171691567) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 171691567 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | CN(CC1CCN(c2ccc(C(C)(C)C)nn2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C16H28N4O2S/c1-16(2,3)14-6-7-15(18-17-14)20-10-8-13(9-11-20)12-19(4)23(5,21)22/h6-7,13H,8-12H2,1-5H3 |
| InChIKey | DIZGVHPLOQOXCH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |