About N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide
N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 171691557) has the molecular formula C14H24N4O2S
and a molecular weight of 312.44 g/mol. Its IUPAC name is N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide |
| PubChem CID | 171691557 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | Cc1cc(N2CCC(CN(C)S(C)(=O)=O)CC2)nnc1C |
| InChI | InChI=1S/C14H24N4O2S/c1-11-9-14(16-15-12(11)2)18-7-5-13(6-8-18)10-17(3)21(4,19)20/h9,13H,5-8,10H2,1-4H3 |
| InChIKey | UQGFQGAULYDWGK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide (CID 171691557) is N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide is Cc1cc(N2CCC(CN(C)S(C)(=O)=O)CC2)nnc1C.
What is the InChIKey of N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide?
The InChIKey is UQGFQGAULYDWGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O2S/c1-11-9-14(16-15-12(11)2)18-7-5-13(6-8-18)10-17(3)21(4,19)20/h9,13H,5-8,10H2,1-4H3.
What are the key properties of N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide?
N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide has a molecular weight of 312.44 g/mol, XLogP of 1.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(5,6-dimethylpyridazin-3-yl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 171691557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).