C13H19BrClN3O2S — CID 171690975
N-[[1-(5-bromo-3-chloro-2-pyridinyl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 171690975) has the molecular formula C13H19BrClN3O2S and a molecular weight of 396.74 g/mol. Its IUPAC name is N-[[1-(5-bromo-3-chloro-2-pyridinyl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[[1-(5-bromo-3-chloro-2-pyridinyl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 171690975 |
| Molecular Formula | C13H19BrClN3O2S |
| Molecular Weight | 396.74 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | N-[[1-(5-bromo-3-chloro-2-pyridinyl)piperidin-4-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | CN(CC1CCN(c2ncc(Br)cc2Cl)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C13H19BrClN3O2S/c1-17(21(2,19)20)9-10-3-5-18(6-4-10)13-12(15)7-11(14)8-16-13/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | VIQQRAVLPYJCCA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.74 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |