C28H32N4O3 — CID 16661310
N-(2-aminophenyl)-6-[1-[(4-methoxyphenyl)methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]hexanamide (PubChem CID 16661310) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[1-[(4-methoxyphenyl)methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]hexanamide.
| Compound Name | N-(2-aminophenyl)-6-[1-[(4-methoxyphenyl)methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]hexanamide |
|---|---|
| PubChem CID | 16661310 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-(2-aminophenyl)-6-[1-[(4-methoxyphenyl)methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]hexanamide |
| SMILES | COc1ccc(CN2c3ccccc3NC(=O)C2CCCCCC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C28H32N4O3/c1-35-21-17-15-20(16-18-21)19-32-25-12-8-7-11-24(25)31-28(34)26(32)13-3-2-4-14-27(33)30-23-10-6-5-9-22(23)29/h5-12,15-18,26H,2-4,13-14,19,29H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | VCGDWODNRIURDS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|