C34H38N4O5 — CID 143414725
N-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-nitrophenyl]-6-[1-[(4-methoxyphenyl)methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]hexanamide (PubChem CID 143414725) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is N-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-nitrophenyl]-6-[1-[(4-methoxyphenyl)methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]hexanamide.
| Compound Name | N-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-nitrophenyl]-6-[1-[(4-methoxyphenyl)methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]hexanamide |
|---|---|
| PubChem CID | 143414725 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | N-[5-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-nitrophenyl]-6-[1-[(4-methoxyphenyl)methyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]hexanamide |
| SMILES | C/C=C\C=C(/C)c1ccc([N+](=O)[O-])c(NC(=O)CCCCCC2C(=O)Nc3ccccc3N2Cc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C34H38N4O5/c1-4-5-11-24(2)26-18-21-31(38(41)42)29(22-26)35-33(39)15-8-6-7-14-32-34(40)36-28-12-9-10-13-30(28)37(32)23-25-16-19-27(43-3)20-17-25/h4-5,9-13,16-22,32H,6-8,14-15,23H2,1-3H3,(H,35,39)(H,36,40)/b5-4-,24-11+ |
| InChIKey | MNDJJINRXFTCPT-QVCVUPFASA-N |
| XLogP | 7.50 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|