C21H25ClN2O3 — CID 166613410
3-[(4-chlorophenyl)methyl]-N-[[4-(2-methoxyethoxy)phenyl]methyl]azetidine-3-carboxamide (PubChem CID 166613410) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-N-[[4-(2-methoxyethoxy)phenyl]methyl]azetidine-3-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-N-[[4-(2-methoxyethoxy)phenyl]methyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 166613410 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-N-[[4-(2-methoxyethoxy)phenyl]methyl]azetidine-3-carboxamide |
| SMILES | COCCOc1ccc(CNC(=O)C2(Cc3ccc(Cl)cc3)CNC2)cc1 |
| InChI | InChI=1S/C21H25ClN2O3/c1-26-10-11-27-19-8-4-17(5-9-19)13-24-20(25)21(14-23-15-21)12-16-2-6-18(22)7-3-16/h2-9,23H,10-15H2,1H3,(H,24,25) |
| InChIKey | NDWGALNZYQONAK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|