C22H27N5O4 — CID 166616607
1-benzyl-3-(2-ethoxyethyl)-8-(6-oxo-1H-pyrimidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 166616607) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is 1-benzyl-3-(2-ethoxyethyl)-8-(6-oxo-1H-pyrimidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-3-(2-ethoxyethyl)-8-(6-oxo-1H-pyrimidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 166616607 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-benzyl-3-(2-ethoxyethyl)-8-(6-oxo-1H-pyrimidin-4-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCOCCN1C(=O)N(Cc2ccccc2)C2(CCN(c3cc(=O)[nH]cn3)CC2)C1=O |
| InChI | InChI=1S/C22H27N5O4/c1-2-31-13-12-26-20(29)22(27(21(26)30)15-17-6-4-3-5-7-17)8-10-25(11-9-22)18-14-19(28)24-16-23-18/h3-7,14,16H,2,8-13,15H2,1H3,(H,23,24,28) |
| InChIKey | YRLXTYBFTQPGJT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|