C22H30N4O4 — CID 166617238
8-(1,3-benzoxazol-2-yl)-3-(3-methoxypropyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 166617238) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 8-(1,3-benzoxazol-2-yl)-3-(3-methoxypropyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(1,3-benzoxazol-2-yl)-3-(3-methoxypropyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 166617238 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 8-(1,3-benzoxazol-2-yl)-3-(3-methoxypropyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCCN1C(=O)N(CC(C)C)C2(CCN(c3nc4ccccc4o3)CC2)C1=O |
| InChI | InChI=1S/C22H30N4O4/c1-16(2)15-26-21(28)25(11-6-14-29-3)19(27)22(26)9-12-24(13-10-22)20-23-17-7-4-5-8-18(17)30-20/h4-5,7-8,16H,6,9-15H2,1-3H3 |
| InChIKey | RNKFVPVNKJLBND-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|