C17H10F2N2S — CID 16662193
4-[2-[6-(3,4-difluorophenyl)-3-pyridinyl]ethynyl]-2-methyl-1,3-thiazole (PubChem CID 16662193) has the molecular formula C17H10F2N2S and a molecular weight of 312.34 g/mol. Its IUPAC name is 4-[2-[6-(3,4-difluorophenyl)-3-pyridinyl]ethynyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[2-[6-(3,4-difluorophenyl)-3-pyridinyl]ethynyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 16662193 |
| Molecular Formula | C17H10F2N2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-[2-[6-(3,4-difluorophenyl)-3-pyridinyl]ethynyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(C#Cc2ccc(-c3ccc(F)c(F)c3)nc2)cs1 |
| InChI | InChI=1S/C17H10F2N2S/c1-11-21-14(10-22-11)5-2-12-3-7-17(20-9-12)13-4-6-15(18)16(19)8-13/h3-4,6-10H,1H3 |
| InChIKey | GQBOLRQEFSOSAI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|