C24H28FN3O2 — CID 166623175
2-[(3aR,6aS)-5-[2-(3-fluorophenyl)acetyl]-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]acetamide (PubChem CID 166623175) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-[2-(3-fluorophenyl)acetyl]-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]acetamide.
| Compound Name | 2-[(3aR,6aS)-5-[2-(3-fluorophenyl)acetyl]-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]acetamide |
|---|---|
| PubChem CID | 166623175 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2-[(3aR,6aS)-5-[2-(3-fluorophenyl)acetyl]-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]acetamide |
| SMILES | NC(=O)CN1C[C@H]2CN(C(=O)Cc3cccc(F)c3)C[C@@]2(CCc2ccccc2)C1 |
| InChI | InChI=1S/C24H28FN3O2/c25-21-8-4-7-19(11-21)12-23(30)28-14-20-13-27(15-22(26)29)16-24(20,17-28)10-9-18-5-2-1-3-6-18/h1-8,11,20H,9-10,12-17H2,(H2,26,29)/t20-,24+/m0/s1 |
| InChIKey | LEOAGNDJYXKOFP-GBXCKJPGSA-N |
| XLogP | 2.25 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |