C35H35N5O3S — CID 16662472
N-[(5S)-5-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]thiophene-2-carboxamide (PubChem CID 16662472) has the molecular formula C35H35N5O3S and a molecular weight of 605.76 g/mol. Its IUPAC name is N-[(5S)-5-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]thiophene-2-carboxamide.
| Compound Name | N-[(5S)-5-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16662472 |
| Molecular Formula | C35H35N5O3S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | N-[(5S)-5-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-5-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]thiophene-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCNC(=O)c3cccs3)c3ncc(-c4ccc5ccccc5c4)[nH]3)c2c1 |
| InChI | InChI=1S/C35H35N5O3S/c1-22-27(28-19-26(43-2)14-15-29(28)38-22)20-33(41)39-30(10-5-6-16-36-35(42)32-11-7-17-44-32)34-37-21-31(40-34)25-13-12-23-8-3-4-9-24(23)18-25/h3-4,7-9,11-15,17-19,21,30,38H,5-6,10,16,20H2,1-2H3,(H,36,42)(H,37,40)(H,39,41)/t30-/m0/s1 |
| InChIKey | JVIGWMDJYUHXLV-PMERELPUSA-N |
| XLogP | 7.09 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|