C21H34O3 — CID 166627857
(1S,2R,3S,4R,6R,7R,8R,14R)-4-ethyl-3,6-dihydroxy-2,4,7,14-tetramethyl-10-methylidenetricyclo[5.4.3.01,8]tetradecan-9-one (PubChem CID 166627857) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1S,2R,3S,4R,6R,7R,8R,14R)-4-ethyl-3,6-dihydroxy-2,4,7,14-tetramethyl-10-methylidenetricyclo[5.4.3.01,8]tetradecan-9-one.
| Compound Name | (1S,2R,3S,4R,6R,7R,8R,14R)-4-ethyl-3,6-dihydroxy-2,4,7,14-tetramethyl-10-methylidenetricyclo[5.4.3.01,8]tetradecan-9-one |
|---|---|
| PubChem CID | 166627857 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (1S,2R,3S,4R,6R,7R,8R,14R)-4-ethyl-3,6-dihydroxy-2,4,7,14-tetramethyl-10-methylidenetricyclo[5.4.3.01,8]tetradecan-9-one |
| SMILES | C=C1C[C@@]23CC[C@@H](C)[C@@](C)([C@H](O)C[C@@](C)(CC)[C@@H](O)[C@@H]2C)[C@@H]3C1=O |
| InChI | InChI=1S/C21H34O3/c1-7-19(5)11-15(22)20(6)13(3)8-9-21(14(4)18(19)24)10-12(2)16(23)17(20)21/h13-15,17-18,22,24H,2,7-11H2,1,3-6H3/t13-,14+,15-,17+,18+,19-,20+,21+/m1/s1 |
| InChIKey | MSMGNJJFSIQYKJ-TWGYPCCDSA-N |
| XLogP | 3.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|