C30H27F6N2OP — CID 166628666
1-benzyl-3-[(3-methoxyphenyl)methyl]-4,5-diphenylimidazol-3-ium hexafluorophosphate (PubChem CID 166628666) has the molecular formula C30H27F6N2OP and a molecular weight of 576.52 g/mol. Its IUPAC name is 1-benzyl-3-[(3-methoxyphenyl)methyl]-4,5-diphenylimidazol-3-ium hexafluorophosphate.
| Compound Name | 1-benzyl-3-[(3-methoxyphenyl)methyl]-4,5-diphenylimidazol-3-ium hexafluorophosphate |
|---|---|
| PubChem CID | 166628666 |
| Molecular Formula | C30H27F6N2OP |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 1-benzyl-3-[(3-methoxyphenyl)methyl]-4,5-diphenylimidazol-3-ium hexafluorophosphate |
| SMILES | COc1cccc(C[n+]2cn(Cc3ccccc3)c(-c3ccccc3)c2-c2ccccc2)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C30H27N2O.F6P/c1-33-28-19-11-14-25(20-28)22-32-23-31(21-24-12-5-2-6-13-24)29(26-15-7-3-8-16-26)30(32)27-17-9-4-10-18-27;1-7(2,3,4,5)6/h2-20,23H,21-22H2,1H3;/q+1;-1 |
| InChIKey | CYNUIQSELRZLIE-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|