C23H23Cl2F3N2O5 — CID 166629475
[6-chloro-7-methoxy-2-methyl-3-[4-(trifluoromethyl)phenyl]quinolin-4-yl]oxymethyl 2-(methylamino)ethyl carbonate;hydrochloride (PubChem CID 166629475) has the molecular formula C23H23Cl2F3N2O5 and a molecular weight of 535.35 g/mol. Its IUPAC name is [6-chloro-7-methoxy-2-methyl-3-[4-(trifluoromethyl)phenyl]quinolin-4-yl]oxymethyl 2-(methylamino)ethyl carbonate;hydrochloride.
| Compound Name | [6-chloro-7-methoxy-2-methyl-3-[4-(trifluoromethyl)phenyl]quinolin-4-yl]oxymethyl 2-(methylamino)ethyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 166629475 |
| Molecular Formula | C23H23Cl2F3N2O5 |
| Molecular Weight | 535.35 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | [6-chloro-7-methoxy-2-methyl-3-[4-(trifluoromethyl)phenyl]quinolin-4-yl]oxymethyl 2-(methylamino)ethyl carbonate;hydrochloride |
| SMILES | CNCCOC(=O)OCOc1c(-c2ccc(C(F)(F)F)cc2)c(C)nc2cc(OC)c(Cl)cc12.Cl |
| InChI | InChI=1S/C23H22ClF3N2O5.ClH/c1-13-20(14-4-6-15(7-5-14)23(25,26)27)21(33-12-34-22(30)32-9-8-28-2)16-10-17(24)19(31-3)11-18(16)29-13;/h4-7,10-11,28H,8-9,12H2,1-3H3;1H |
| InChIKey | IVBGAWYQQCHHAO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.35 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|