C27H24F3N3O4 — CID 170159674
2-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 170159674) has the molecular formula C27H24F3N3O4 and a molecular weight of 511.50 g/mol. Its IUPAC name is 2-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 170159674 |
| Molecular Formula | C27H24F3N3O4 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 2-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCOc1cc2ncnc(-c3ccc(C(C(N)=O)c4ccc(C(F)(F)F)cc4)cc3)c2cc1OC |
| InChI | InChI=1S/C27H24F3N3O4/c1-35-11-12-37-23-14-21-20(13-22(23)36-2)25(33-15-32-21)18-5-3-16(4-6-18)24(26(31)34)17-7-9-19(10-8-17)27(28,29)30/h3-10,13-15,24H,11-12H2,1-2H3,(H2,31,34) |
| InChIKey | YUIOGRNPILDHMV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|