C29H28F3N3O5 — CID 170160385
2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 170160385) has the molecular formula C29H28F3N3O5 and a molecular weight of 555.55 g/mol. Its IUPAC name is 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 170160385 |
| Molecular Formula | C29H28F3N3O5 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCOc1cc2ncnc(-c3ccc(C(C(N)=O)c4ccc(C(F)(F)F)cc4)cc3)c2cc1OCCOC |
| InChI | InChI=1S/C29H28F3N3O5/c1-37-11-13-39-24-15-22-23(16-25(24)40-14-12-38-2)34-17-35-27(22)20-5-3-18(4-6-20)26(28(33)36)19-7-9-21(10-8-19)29(30,31)32/h3-10,15-17,26H,11-14H2,1-2H3,(H2,33,36) |
| InChIKey | YKNKRFBLRPDMHQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|