C26H25ClN4O4 — CID 175258585
(E)-3-amino-3-[4-(aminomethyl)phenyl]-2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]prop-2-enoic acid;hydrochloride (PubChem CID 175258585) has the molecular formula C26H25ClN4O4 and a molecular weight of 492.96 g/mol. Its IUPAC name is (E)-3-amino-3-[4-(aminomethyl)phenyl]-2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]prop-2-enoic acid;hydrochloride.
| Compound Name | (E)-3-amino-3-[4-(aminomethyl)phenyl]-2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]prop-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 175258585 |
| Molecular Formula | C26H25ClN4O4 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (E)-3-amino-3-[4-(aminomethyl)phenyl]-2-[4-(6,7-dimethoxyquinazolin-4-yl)phenyl]prop-2-enoic acid;hydrochloride |
| SMILES | COc1cc2ncnc(-c3ccc(/C(C(=O)O)=C(\N)c4ccc(CN)cc4)cc3)c2cc1OC.Cl |
| InChI | InChI=1S/C26H24N4O4.ClH/c1-33-21-11-19-20(12-22(21)34-2)29-14-30-25(19)18-9-7-16(8-10-18)23(26(31)32)24(28)17-5-3-15(13-27)4-6-17;/h3-12,14H,13,27-28H2,1-2H3,(H,31,32);1H/b24-23+; |
| InChIKey | LKSMKNPFGSFACU-XMXXDQCKSA-N |
| XLogP | 4.11 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|