C16H16N3O4P — CID 163399431
[5-(6,7-dimethoxyquinazolin-4-yl)-2-pyridinyl]methylphosphonous acid (PubChem CID 163399431) has the molecular formula C16H16N3O4P and a molecular weight of 345.30 g/mol. Its IUPAC name is [5-(6,7-dimethoxyquinazolin-4-yl)-2-pyridinyl]methylphosphonous acid.
| Compound Name | [5-(6,7-dimethoxyquinazolin-4-yl)-2-pyridinyl]methylphosphonous acid |
|---|---|
| PubChem CID | 163399431 |
| Molecular Formula | C16H16N3O4P |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [5-(6,7-dimethoxyquinazolin-4-yl)-2-pyridinyl]methylphosphonous acid |
| SMILES | COc1cc2ncnc(-c3ccc(CP(O)O)nc3)c2cc1OC |
| InChI | InChI=1S/C16H16N3O4P/c1-22-14-5-12-13(6-15(14)23-2)18-9-19-16(12)10-3-4-11(17-7-10)8-24(20)21/h3-7,9,20-21H,8H2,1-2H3 |
| InChIKey | DGDIQNUUPXYVQP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|