C18H15N3O2 — CID 139771354
2-(6,7-dimethoxyquinazolin-4-yl)-4-ethynylaniline (PubChem CID 139771354) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(6,7-dimethoxyquinazolin-4-yl)-4-ethynylaniline.
| Compound Name | 2-(6,7-dimethoxyquinazolin-4-yl)-4-ethynylaniline |
|---|---|
| PubChem CID | 139771354 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(6,7-dimethoxyquinazolin-4-yl)-4-ethynylaniline |
| SMILES | C#Cc1ccc(N)c(-c2ncnc3cc(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C18H15N3O2/c1-4-11-5-6-14(19)12(7-11)18-13-8-16(22-2)17(23-3)9-15(13)20-10-21-18/h1,5-10H,19H2,2-3H3 |
| InChIKey | IMTFUGRDBOEIJW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|