C15H13BrN4O2 — CID 21114586
6-bromo-2-(6,7-dimethoxyquinazolin-4-yl)pyridin-3-amine (PubChem CID 21114586) has the molecular formula C15H13BrN4O2 and a molecular weight of 361.20 g/mol. Its IUPAC name is 6-bromo-2-(6,7-dimethoxyquinazolin-4-yl)pyridin-3-amine.
| Compound Name | 6-bromo-2-(6,7-dimethoxyquinazolin-4-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 21114586 |
| Molecular Formula | C15H13BrN4O2 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 6-bromo-2-(6,7-dimethoxyquinazolin-4-yl)pyridin-3-amine |
| SMILES | COc1cc2ncnc(-c3nc(Br)ccc3N)c2cc1OC |
| InChI | InChI=1S/C15H13BrN4O2/c1-21-11-5-8-10(6-12(11)22-2)18-7-19-14(8)15-9(17)3-4-13(16)20-15/h3-7H,17H2,1-2H3 |
| InChIKey | MLMSWIYRHZODSK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|