C29H35ClN2O7 — CID 130247516
[6-chloro-7-methoxy-2-methyl-3-(2-methylphenyl)quinolin-4-yl]oxymethyl 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl carbonate (PubChem CID 130247516) has the molecular formula C29H35ClN2O7 and a molecular weight of 559.06 g/mol. Its IUPAC name is [6-chloro-7-methoxy-2-methyl-3-(2-methylphenyl)quinolin-4-yl]oxymethyl 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl carbonate.
| Compound Name | [6-chloro-7-methoxy-2-methyl-3-(2-methylphenyl)quinolin-4-yl]oxymethyl 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl carbonate |
|---|---|
| PubChem CID | 130247516 |
| Molecular Formula | C29H35ClN2O7 |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | [6-chloro-7-methoxy-2-methyl-3-(2-methylphenyl)quinolin-4-yl]oxymethyl 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl carbonate |
| SMILES | COc1cc2nc(C)c(-c3ccccc3C)c(OCOC(=O)OCCCN(C)C(=O)OC(C)(C)C)c2cc1Cl |
| InChI | InChI=1S/C29H35ClN2O7/c1-18-11-8-9-12-20(18)25-19(2)31-23-16-24(35-7)22(30)15-21(23)26(25)37-17-38-28(34)36-14-10-13-32(6)27(33)39-29(3,4)5/h8-9,11-12,15-16H,10,13-14,17H2,1-7H3 |
| InChIKey | OSNDMASNTOLFGY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 96.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|