C25H21N5O4S3 — CID 166629757
2-[5-cyano-4-(1,3-thiazol-2-ylsulfanyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]sulfanyl-N-phenylacetamide (PubChem CID 166629757) has the molecular formula C25H21N5O4S3 and a molecular weight of 551.68 g/mol. Its IUPAC name is 2-[5-cyano-4-(1,3-thiazol-2-ylsulfanyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[5-cyano-4-(1,3-thiazol-2-ylsulfanyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 166629757 |
| Molecular Formula | C25H21N5O4S3 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2-[5-cyano-4-(1,3-thiazol-2-ylsulfanyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]sulfanyl-N-phenylacetamide |
| SMILES | COc1cc(-c2nc(SCC(=O)Nc3ccccc3)nc(Sc3nccs3)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C25H21N5O4S3/c1-32-18-11-15(12-19(33-2)22(18)34-3)21-17(13-26)23(37-25-27-9-10-35-25)30-24(29-21)36-14-20(31)28-16-7-5-4-6-8-16/h4-12H,14H2,1-3H3,(H,28,31) |
| InChIKey | UFWOIYSVUCDACE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|