C33H27ClN4O4S2 — CID 23889414
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanamide (PubChem CID 23889414) has the molecular formula C33H27ClN4O4S2 and a molecular weight of 643.19 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 23889414 |
| Molecular Formula | C33H27ClN4O4S2 |
| Molecular Weight | 643.19 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]propanamide |
| SMILES | COc1cc(-c2cc(-c3ccccc3)nc(SCCC(=O)Nc3nc(-c4ccc(Cl)cc4)cs3)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C33H27ClN4O4S2/c1-40-28-15-22(16-29(41-2)31(28)42-3)24-17-26(20-7-5-4-6-8-20)36-32(25(24)18-35)43-14-13-30(39)38-33-37-27(19-44-33)21-9-11-23(34)12-10-21/h4-12,15-17,19H,13-14H2,1-3H3,(H,37,38,39) |
| InChIKey | UGHORECUUSUBAD-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.19 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|