C19H13F4NO5S2 — CID 166630130
N-[2-(4-fluorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide (PubChem CID 166630130) has the molecular formula C19H13F4NO5S2 and a molecular weight of 475.44 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-(4-fluorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166630130 |
| Molecular Formula | C19H13F4NO5S2 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | N-[2-(4-fluorophenoxy)-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1Oc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H13F4NO5S2/c20-13-6-8-14(9-7-13)29-18-12-16(30(25,26)19(21,22)23)10-11-17(18)24-31(27,28)15-4-2-1-3-5-15/h1-12,24H |
| InChIKey | PJEOGUMNYAOSLL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |