C13H19N3O4 — CID 166630178
N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]furan-3-carboxamide (PubChem CID 166630178) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 166630178 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]furan-3-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccoc1)C(=O)NCC(N)=O |
| InChI | InChI=1S/C13H19N3O4/c1-8(2)5-10(13(19)15-6-11(14)17)16-12(18)9-3-4-20-7-9/h3-4,7-8,10H,5-6H2,1-2H3,(H2,14,17)(H,15,19)(H,16,18)/t10-/m0/s1 |
| InChIKey | RYAUDQTUUTVOSS-JTQLQIEISA-N |
| XLogP | 0.03 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |