C23H25N5O4S2 — CID 16663033
3-[(E)-2-[2-(4-piperidin-4-ylsulfonylanilino)pyrimidin-5-yl]ethenyl]benzenesulfonamide (PubChem CID 16663033) has the molecular formula C23H25N5O4S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 3-[(E)-2-[2-(4-piperidin-4-ylsulfonylanilino)pyrimidin-5-yl]ethenyl]benzenesulfonamide.
| Compound Name | 3-[(E)-2-[2-(4-piperidin-4-ylsulfonylanilino)pyrimidin-5-yl]ethenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16663033 |
| Molecular Formula | C23H25N5O4S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 3-[(E)-2-[2-(4-piperidin-4-ylsulfonylanilino)pyrimidin-5-yl]ethenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(/C=C/c2cnc(Nc3ccc(S(=O)(=O)C4CCNCC4)cc3)nc2)c1 |
| InChI | InChI=1S/C23H25N5O4S2/c24-34(31,32)22-3-1-2-17(14-22)4-5-18-15-26-23(27-16-18)28-19-6-8-20(9-7-19)33(29,30)21-10-12-25-13-11-21/h1-9,14-16,21,25H,10-13H2,(H2,24,31,32)(H,26,27,28)/b5-4+ |
| InChIKey | BSDDABOVZZKKLF-SNAWJCMRSA-N |
| XLogP | 2.56 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |