C24H26N4O3S — CID 69442412
3-[2-[4-methyl-2-(4-piperidin-4-ylsulfonylanilino)pyrimidin-5-yl]ethenyl]phenol (PubChem CID 69442412) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 3-[2-[4-methyl-2-(4-piperidin-4-ylsulfonylanilino)pyrimidin-5-yl]ethenyl]phenol.
| Compound Name | 3-[2-[4-methyl-2-(4-piperidin-4-ylsulfonylanilino)pyrimidin-5-yl]ethenyl]phenol |
|---|---|
| PubChem CID | 69442412 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 3-[2-[4-methyl-2-(4-piperidin-4-ylsulfonylanilino)pyrimidin-5-yl]ethenyl]phenol |
| SMILES | Cc1nc(Nc2ccc(S(=O)(=O)C3CCNCC3)cc2)ncc1C=Cc1cccc(O)c1 |
| InChI | InChI=1S/C24H26N4O3S/c1-17-19(6-5-18-3-2-4-21(29)15-18)16-26-24(27-17)28-20-7-9-22(10-8-20)32(30,31)23-11-13-25-14-12-23/h2-10,15-16,23,25,29H,11-14H2,1H3,(H,26,27,28) |
| InChIKey | BJZMEDYYUHNQSP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |