C21H15BrClF4N3O4 — CID 166632089
N-(2-bromo-6-chlorophenyl)-4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide (PubChem CID 166632089) has the molecular formula C21H15BrClF4N3O4 and a molecular weight of 564.72 g/mol. Its IUPAC name is N-(2-bromo-6-chlorophenyl)-4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide.
| Compound Name | N-(2-bromo-6-chlorophenyl)-4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 166632089 |
| Molecular Formula | C21H15BrClF4N3O4 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 562.99 |
| IUPAC Name | N-(2-bromo-6-chlorophenyl)-4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide |
| SMILES | C/C(O)=C(\C#N)C(=O)Nc1cc(O[C@@H](C)C(F)(F)F)c(C(=O)Nc2c(Cl)cccc2Br)cc1F |
| InChI | InChI=1S/C21H15BrClF4N3O4/c1-9(31)12(8-28)20(33)29-16-7-17(34-10(2)21(25,26)27)11(6-15(16)24)19(32)30-18-13(22)4-3-5-14(18)23/h3-7,10,31H,1-2H3,(H,29,33)(H,30,32)/b12-9-/t10-/m0/s1 |
| InChIKey | NLTHKTHENWGQEJ-JMZICWNOSA-N |
| XLogP | 6.12 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|