C21H19F2N3O4 — CID 166636479
4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-N-(3-fluorophenyl)-2-propan-2-yloxybenzamide (PubChem CID 166636479) has the molecular formula C21H19F2N3O4 and a molecular weight of 415.40 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-N-(3-fluorophenyl)-2-propan-2-yloxybenzamide.
| Compound Name | 4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-N-(3-fluorophenyl)-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 166636479 |
| Molecular Formula | C21H19F2N3O4 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-N-(3-fluorophenyl)-2-propan-2-yloxybenzamide |
| SMILES | C/C(O)=C(\C#N)C(=O)Nc1cc(OC(C)C)c(C(=O)Nc2cccc(F)c2)cc1F |
| InChI | InChI=1S/C21H19F2N3O4/c1-11(2)30-19-9-18(26-21(29)16(10-24)12(3)27)17(23)8-15(19)20(28)25-14-6-4-5-13(22)7-14/h4-9,11,27H,1-3H3,(H,25,28)(H,26,29)/b16-12- |
| InChIKey | HVWPCROIBVLMRH-VBKFSLOCSA-N |
| XLogP | 4.30 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|