C22H22FN3O5 — CID 166626645
4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-N-(2-methoxyphenyl)-2-propan-2-yloxybenzamide (PubChem CID 166626645) has the molecular formula C22H22FN3O5 and a molecular weight of 427.43 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-N-(2-methoxyphenyl)-2-propan-2-yloxybenzamide.
| Compound Name | 4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-N-(2-methoxyphenyl)-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 166626645 |
| Molecular Formula | C22H22FN3O5 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-hydroxybut-2-enoyl]amino]-5-fluoro-N-(2-methoxyphenyl)-2-propan-2-yloxybenzamide |
| SMILES | COc1ccccc1NC(=O)c1cc(F)c(NC(=O)/C(C#N)=C(/C)O)cc1OC(C)C |
| InChI | InChI=1S/C22H22FN3O5/c1-12(2)31-20-10-18(26-22(29)15(11-24)13(3)27)16(23)9-14(20)21(28)25-17-7-5-6-8-19(17)30-4/h5-10,12,27H,1-4H3,(H,25,28)(H,26,29)/b15-13- |
| InChIKey | XUELZEHCBPPICM-SQFISAMPSA-N |
| XLogP | 4.17 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|