C31H40O3Si — CID 16663405
2-[2-[5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]furan-2-yl]cyclohex-2-en-1-yl]ethanol (PubChem CID 16663405) has the molecular formula C31H40O3Si and a molecular weight of 488.74 g/mol. Its IUPAC name is 2-[2-[5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]furan-2-yl]cyclohex-2-en-1-yl]ethanol.
| Compound Name | 2-[2-[5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]furan-2-yl]cyclohex-2-en-1-yl]ethanol |
|---|---|
| PubChem CID | 16663405 |
| Molecular Formula | C31H40O3Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 2-[2-[5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]furan-2-yl]cyclohex-2-en-1-yl]ethanol |
| SMILES | CC(C)(C)[Si](OCCCc1ccc(C2=CCCCC2CCO)o1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40O3Si/c1-31(2,3)35(27-15-6-4-7-16-27,28-17-8-5-9-18-28)33-24-12-14-26-20-21-30(34-26)29-19-11-10-13-25(29)22-23-32/h4-9,15-21,25,32H,10-14,22-24H2,1-3H3 |
| InChIKey | PUROUIRFFJPQKY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|