C18H14FN3OS — CID 166634052
(E)-N-(2-aminophenyl)-3-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]prop-2-enamide (PubChem CID 166634052) has the molecular formula C18H14FN3OS and a molecular weight of 339.40 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 166634052 |
| Molecular Formula | C18H14FN3OS |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1cnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H14FN3OS/c19-13-7-5-12(6-8-13)18-21-11-14(24-18)9-10-17(23)22-16-4-2-1-3-15(16)20/h1-11H,20H2,(H,22,23)/b10-9+ |
| InChIKey | UOQOWQJBQNUNNE-MDZDMXLPSA-N |
| XLogP | 4.18 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|