C23H33BO2Si — CID 166636950
deuterio-phenyl-(2-phenylethyl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane (PubChem CID 166636950) has the molecular formula C23H33BO2Si and a molecular weight of 381.42 g/mol. Its IUPAC name is deuterio-phenyl-(2-phenylethyl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane.
| Compound Name | deuterio-phenyl-(2-phenylethyl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane |
|---|---|
| PubChem CID | 166636950 |
| Molecular Formula | C23H33BO2Si |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | deuterio-phenyl-(2-phenylethyl)-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane |
| SMILES | [2H][Si](CCCB1OC(C)(C)C(C)(C)O1)(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H33BO2Si/c1-22(2)23(3,4)26-24(25-22)17-11-18-27(21-14-9-6-10-15-21)19-16-20-12-7-5-8-13-20/h5-10,12-15,27H,11,16-19H2,1-4H3/i27D |
| InChIKey | RSPXZFWZUKMBIL-BPVCDHNKSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|