About 2-phenylselenyl benzaldehyde
2-phenylselenyl benzaldehyde (PubChem CID 166637347) has the molecular formula C13H9OSe
and a molecular weight of 260.17 g/mol.
Molecular Properties
| Compound Name | 2-phenylselenyl benzaldehyde |
| PubChem CID | 166637347 |
| Molecular Formula | C13H9OSe |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | — |
| SMILES | O=Cc1cccc([Se])c1-c1ccccc1 |
| InChI | InChI=1S/C13H9OSe/c14-9-11-7-4-8-12(15)13(11)10-5-2-1-3-6-10/h1-9H |
| InChIKey | HLFRLSUYQXJRKJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylselenyl benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylselenyl benzaldehyde?
The IUPAC name of 2-phenylselenyl benzaldehyde (CID 166637347) is not available.
What is the SMILES notation for 2-phenylselenyl benzaldehyde?
The canonical SMILES for 2-phenylselenyl benzaldehyde is O=Cc1cccc([Se])c1-c1ccccc1.
What is the InChIKey of 2-phenylselenyl benzaldehyde?
The InChIKey is HLFRLSUYQXJRKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9OSe/c14-9-11-7-4-8-12(15)13(11)10-5-2-1-3-6-10/h1-9H.
What are the key properties of 2-phenylselenyl benzaldehyde?
2-phenylselenyl benzaldehyde has a molecular weight of 260.17 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylselenyl benzaldehyde is sourced from PubChem (CID 166637347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).