About CID 167433700
CID 167433700 (PubChem CID 167433700) has the molecular formula C8H5O2Se
and a molecular weight of 212.09 g/mol.
Molecular Properties
| Compound Name | CID 167433700 |
| PubChem CID | 167433700 |
| Molecular Formula | C8H5O2Se |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 212.95 |
| IUPAC Name | — |
| SMILES | O=Cc1cccc([Se])c1C=O |
| InChI | InChI=1S/C8H5O2Se/c9-4-6-2-1-3-8(11)7(6)5-10/h1-5H |
| InChIKey | COFYNZSTULOPEI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167433700 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167433700?
The IUPAC name of CID 167433700 (CID 167433700) is not available.
What is the SMILES notation for CID 167433700?
The canonical SMILES for CID 167433700 is O=Cc1cccc([Se])c1C=O.
What is the InChIKey of CID 167433700?
The InChIKey is COFYNZSTULOPEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5O2Se/c9-4-6-2-1-3-8(11)7(6)5-10/h1-5H.
What are the key properties of CID 167433700?
CID 167433700 has a molecular weight of 212.09 g/mol, XLogP of 0.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167433700 is sourced from PubChem (CID 167433700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).