C18H17BrFNO2 — CID 166637707
(4-bromo-2-fluoro-6-phenoxyphenyl)-piperidin-1-ylmethanone (PubChem CID 166637707) has the molecular formula C18H17BrFNO2 and a molecular weight of 378.24 g/mol. Its IUPAC name is (4-bromo-2-fluoro-6-phenoxyphenyl)-piperidin-1-ylmethanone.
| Compound Name | (4-bromo-2-fluoro-6-phenoxyphenyl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 166637707 |
| Molecular Formula | C18H17BrFNO2 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (4-bromo-2-fluoro-6-phenoxyphenyl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1c(F)cc(Br)cc1Oc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C18H17BrFNO2/c19-13-11-15(20)17(18(22)21-9-5-2-6-10-21)16(12-13)23-14-7-3-1-4-8-14/h1,3-4,7-8,11-12H,2,5-6,9-10H2 |
| InChIKey | ODRSNQNCZOISKE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |