C23H26BrNO4S — CID 16664069
ethyl (1E,2E)-2-(1-bromo-2-oxo-2-phenylethylidene)-N-(4-methylphenyl)sulfonylhexanimidate (PubChem CID 16664069) has the molecular formula C23H26BrNO4S and a molecular weight of 492.44 g/mol. Its IUPAC name is ethyl (1E,2E)-2-(1-bromo-2-oxo-2-phenylethylidene)-N-(4-methylphenyl)sulfonylhexanimidate.
| Compound Name | ethyl (1E,2E)-2-(1-bromo-2-oxo-2-phenylethylidene)-N-(4-methylphenyl)sulfonylhexanimidate |
|---|---|
| PubChem CID | 16664069 |
| Molecular Formula | C23H26BrNO4S |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | ethyl (1E,2E)-2-(1-bromo-2-oxo-2-phenylethylidene)-N-(4-methylphenyl)sulfonylhexanimidate |
| SMILES | CCCCC(/C(=N\S(=O)(=O)c1ccc(C)cc1)OCC)=C(\Br)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26BrNO4S/c1-4-6-12-20(21(24)22(26)18-10-8-7-9-11-18)23(29-5-2)25-30(27,28)19-15-13-17(3)14-16-19/h7-11,13-16H,4-6,12H2,1-3H3/b21-20+,25-23+ |
| InChIKey | UHBXVCSGZUFFTL-HBUFWBNWSA-N |
| XLogP | 5.84 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|